About 4-bromo-2,3,5-trimethylphenol
4-bromo-2,3,5-trimethylphenol (PubChem CID 3629334) has the molecular formula C9H11BrO
and a molecular weight of 215.09 g/mol. Its IUPAC name is 4-bromo-2,3,5-trimethylphenol.
Molecular Properties
| Compound Name | 4-bromo-2,3,5-trimethylphenol |
| PubChem CID | 3629334 |
| Molecular Formula | C9H11BrO |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 4-bromo-2,3,5-trimethylphenol |
| SMILES | Cc1cc(O)c(C)c(C)c1Br |
| InChI | InChI=1S/C9H11BrO/c1-5-4-8(11)6(2)7(3)9(5)10/h4,11H,1-3H3 |
| InChIKey | KHQCLZZWQARYJF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-2,3,5-trimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,3,5-trimethylphenol?
The IUPAC name of 4-bromo-2,3,5-trimethylphenol (CID 3629334) is 4-bromo-2,3,5-trimethylphenol.
What is the SMILES notation for 4-bromo-2,3,5-trimethylphenol?
The canonical SMILES for 4-bromo-2,3,5-trimethylphenol is Cc1cc(O)c(C)c(C)c1Br.
What is the InChIKey of 4-bromo-2,3,5-trimethylphenol?
The InChIKey is KHQCLZZWQARYJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrO/c1-5-4-8(11)6(2)7(3)9(5)10/h4,11H,1-3H3.
What are the key properties of 4-bromo-2,3,5-trimethylphenol?
4-bromo-2,3,5-trimethylphenol has a molecular weight of 215.09 g/mol, XLogP of 3.08, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,3,5-trimethylphenol is sourced from PubChem (CID 3629334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).