About Ethyl 3-(3-amino-1h-1,2,4-triazol-1-yl)propanoate
Ethyl 3-(3-amino-1h-1,2,4-triazol-1-yl)propanoate (PubChem CID 363000) has the molecular formula C7H12N4O2
and a molecular weight of 184.20 g/mol. Its IUPAC name is ethyl 3-(3-amino-1,2,4-triazol-1-yl)propanoate.
Molecular Properties
| Compound Name | Ethyl 3-(3-amino-1h-1,2,4-triazol-1-yl)propanoate |
| PubChem CID | 363000 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | ethyl 3-(3-amino-1,2,4-triazol-1-yl)propanoate |
| SMILES | CCOC(=O)CCN1C=NC(=N1)N |
| InChI | InChI=1S/C7H12N4O2/c1-2-13-6(12)3-4-11-5-9-7(8)10-11/h5H,2-4H2,1H3,(H2,8,10) |
| InChIKey | PTJSXKZQDSTMSW-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 83.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | 176 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Ethyl 3-(3-amino-1h-1,2,4-triazol-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethyl 3-(3-amino-1h-1,2,4-triazol-1-yl)propanoate?
The IUPAC name of Ethyl 3-(3-amino-1h-1,2,4-triazol-1-yl)propanoate (CID 363000) is ethyl 3-(3-amino-1,2,4-triazol-1-yl)propanoate.
What is the SMILES notation for Ethyl 3-(3-amino-1h-1,2,4-triazol-1-yl)propanoate?
The canonical SMILES for Ethyl 3-(3-amino-1h-1,2,4-triazol-1-yl)propanoate is CCOC(=O)CCN1C=NC(=N1)N.
What is the InChIKey of Ethyl 3-(3-amino-1h-1,2,4-triazol-1-yl)propanoate?
The InChIKey is PTJSXKZQDSTMSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O2/c1-2-13-6(12)3-4-11-5-9-7(8)10-11/h5H,2-4H2,1H3,(H2,8,10).
What are the key properties of Ethyl 3-(3-amino-1h-1,2,4-triazol-1-yl)propanoate?
Ethyl 3-(3-amino-1h-1,2,4-triazol-1-yl)propanoate has a molecular weight of 184.20 g/mol, XLogP of -0.20, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Ethyl 3-(3-amino-1h-1,2,4-triazol-1-yl)propanoate is sourced from PubChem (CID 363000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).