C16H22BrNO — CID 3630023
1-[(2-bromophenoxy)methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 3630023) has the molecular formula C16H22BrNO and a molecular weight of 324.26 g/mol. Its IUPAC name is 1-[(2-bromophenoxy)methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | 1-[(2-bromophenoxy)methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 3630023 |
| Molecular Formula | C16H22BrNO |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 1-[(2-bromophenoxy)methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | Brc1ccccc1OCC1CCCN2CCCCC12 |
| InChI | InChI=1S/C16H22BrNO/c17-14-7-1-2-9-16(14)19-12-13-6-5-11-18-10-4-3-8-15(13)18/h1-2,7,9,13,15H,3-6,8,10-12H2 |
| InChIKey | VGQWGKXQMOVTKY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |