C14H14Br2N4O2S — CID 3631080
3-(3,5-dibromo-2-methoxyphenyl)-N-(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)prop-2-enamide (PubChem CID 3631080) has the molecular formula C14H14Br2N4O2S and a molecular weight of 462.17 g/mol. Its IUPAC name is 3-(3,5-dibromo-2-methoxyphenyl)-N-(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)prop-2-enamide.
| Compound Name | 3-(3,5-dibromo-2-methoxyphenyl)-N-(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3631080 |
| Molecular Formula | C14H14Br2N4O2S |
| Molecular Weight | 462.17 g/mol |
| Exact Mass | 459.92 |
| IUPAC Name | 3-(3,5-dibromo-2-methoxyphenyl)-N-(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)prop-2-enamide |
| SMILES | COc1c(Br)cc(Br)cc1C=CC(=O)Nn1c(C)nnc1SC |
| InChI | InChI=1S/C14H14Br2N4O2S/c1-8-17-18-14(23-3)20(8)19-12(21)5-4-9-6-10(15)7-11(16)13(9)22-2/h4-7H,1-3H3,(H,19,21) |
| InChIKey | HJJXVBJNJGFQLI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.17 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|