About 1,2-dibromo-4,5-dichloro-3,6-dimethylbenzene
1,2-dibromo-4,5-dichloro-3,6-dimethylbenzene (PubChem CID 3631184) has the molecular formula C8H6Br2Cl2
and a molecular weight of 332.85 g/mol. Its IUPAC name is 1,2-dibromo-4,5-dichloro-3,6-dimethylbenzene.
Molecular Properties
| Compound Name | 1,2-dibromo-4,5-dichloro-3,6-dimethylbenzene |
| PubChem CID | 3631184 |
| Molecular Formula | C8H6Br2Cl2 |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 329.82 |
| IUPAC Name | 1,2-dibromo-4,5-dichloro-3,6-dimethylbenzene |
| SMILES | Cc1c(Cl)c(Cl)c(C)c(Br)c1Br |
| InChI | InChI=1S/C8H6Br2Cl2/c1-3-5(9)6(10)4(2)8(12)7(3)11/h1-2H3 |
| InChIKey | ITLCAMDULGODQR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dibromo-4,5-dichloro-3,6-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dibromo-4,5-dichloro-3,6-dimethylbenzene?
The IUPAC name of 1,2-dibromo-4,5-dichloro-3,6-dimethylbenzene (CID 3631184) is 1,2-dibromo-4,5-dichloro-3,6-dimethylbenzene.
What is the SMILES notation for 1,2-dibromo-4,5-dichloro-3,6-dimethylbenzene?
The canonical SMILES for 1,2-dibromo-4,5-dichloro-3,6-dimethylbenzene is Cc1c(Cl)c(Cl)c(C)c(Br)c1Br.
What is the InChIKey of 1,2-dibromo-4,5-dichloro-3,6-dimethylbenzene?
The InChIKey is ITLCAMDULGODQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Br2Cl2/c1-3-5(9)6(10)4(2)8(12)7(3)11/h1-2H3.
What are the key properties of 1,2-dibromo-4,5-dichloro-3,6-dimethylbenzene?
1,2-dibromo-4,5-dichloro-3,6-dimethylbenzene has a molecular weight of 332.85 g/mol, XLogP of 5.14, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dibromo-4,5-dichloro-3,6-dimethylbenzene is sourced from PubChem (CID 3631184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).