C13H23NO — CID 3631185
N,2,3,4,5,6-hexamethylhepta-3,5-dienamide (PubChem CID 3631185) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is N,2,3,4,5,6-hexamethylhepta-3,5-dienamide.
| Compound Name | N,2,3,4,5,6-hexamethylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 3631185 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N,2,3,4,5,6-hexamethylhepta-3,5-dienamide |
| SMILES | CNC(=O)C(C)C(C)=C(C)C(C)=C(C)C |
| InChI | InChI=1S/C13H23NO/c1-8(2)9(3)10(4)11(5)12(6)13(15)14-7/h12H,1-7H3,(H,14,15) |
| InChIKey | FKDUXRCFUCIEOA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|