About 1,3-dibromo-5,7-dimethyladamantane
1,3-dibromo-5,7-dimethyladamantane (PubChem CID 3631777) has the molecular formula C12H18Br2
and a molecular weight of 322.08 g/mol. Its IUPAC name is 1,3-dibromo-5,7-dimethyladamantane.
Molecular Properties
| Compound Name | 1,3-dibromo-5,7-dimethyladamantane |
| PubChem CID | 3631777 |
| Molecular Formula | C12H18Br2 |
| Molecular Weight | 322.08 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 1,3-dibromo-5,7-dimethyladamantane |
| SMILES | CC12CC3(C)CC(Br)(C1)CC(Br)(C2)C3 |
| InChI | InChI=1S/C12H18Br2/c1-9-3-10(2)6-11(13,4-9)8-12(14,5-9)7-10/h3-8H2,1-2H3 |
| InChIKey | XIWKEBIXYLMOKD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.08 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dibromo-5,7-dimethyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromo-5,7-dimethyladamantane?
The IUPAC name of 1,3-dibromo-5,7-dimethyladamantane (CID 3631777) is 1,3-dibromo-5,7-dimethyladamantane.
What is the SMILES notation for 1,3-dibromo-5,7-dimethyladamantane?
The canonical SMILES for 1,3-dibromo-5,7-dimethyladamantane is CC12CC3(C)CC(Br)(C1)CC(Br)(C2)C3.
What is the InChIKey of 1,3-dibromo-5,7-dimethyladamantane?
The InChIKey is XIWKEBIXYLMOKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18Br2/c1-9-3-10(2)6-11(13,4-9)8-12(14,5-9)7-10/h3-8H2,1-2H3.
What are the key properties of 1,3-dibromo-5,7-dimethyladamantane?
1,3-dibromo-5,7-dimethyladamantane has a molecular weight of 322.08 g/mol, XLogP of 4.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromo-5,7-dimethyladamantane is sourced from PubChem (CID 3631777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).