C23H25ClN4O2S — CID 3631812
N-(2-chlorophenyl)-2-[[4-methyl-5-[(1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)oxymethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3631812) has the molecular formula C23H25ClN4O2S and a molecular weight of 457.00 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[[4-methyl-5-[(1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)oxymethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[[4-methyl-5-[(1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)oxymethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3631812 |
| Molecular Formula | C23H25ClN4O2S |
| Molecular Weight | 457.00 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-(2-chlorophenyl)-2-[[4-methyl-5-[(1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)oxymethyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1c(OCc2nnc(SCC(=O)Nc3ccccc3Cl)n2C)ccc2c1CCCC2 |
| InChI | InChI=1S/C23H25ClN4O2S/c1-15-17-8-4-3-7-16(17)11-12-20(15)30-13-21-26-27-23(28(21)2)31-14-22(29)25-19-10-6-5-9-18(19)24/h5-6,9-12H,3-4,7-8,13-14H2,1-2H3,(H,25,29) |
| InChIKey | COWCGWANLJXHFT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.00 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |