About 6-(dibutylamino)-3,7-dihydropurin-2-one
6-(dibutylamino)-3,7-dihydropurin-2-one (PubChem CID 3631920) has the molecular formula C13H21N5O
and a molecular weight of 263.34 g/mol. Its IUPAC name is 6-(dibutylamino)-3,7-dihydropurin-2-one.
Molecular Properties
| Compound Name | 6-(dibutylamino)-3,7-dihydropurin-2-one |
| PubChem CID | 3631920 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 6-(dibutylamino)-3,7-dihydropurin-2-one |
| SMILES | CCCCN(CCCC)c1nc(=O)[nH]c2nc[nH]c12 |
| InChI | InChI=1S/C13H21N5O/c1-3-5-7-18(8-6-4-2)12-10-11(15-9-14-10)16-13(19)17-12/h9H,3-8H2,1-2H3,(H2,14,15,16,17,19) |
| InChIKey | XVOZQTYYESVLKF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(dibutylamino)-3,7-dihydropurin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dibutylamino)-3,7-dihydropurin-2-one?
The IUPAC name of 6-(dibutylamino)-3,7-dihydropurin-2-one (CID 3631920) is 6-(dibutylamino)-3,7-dihydropurin-2-one.
What is the SMILES notation for 6-(dibutylamino)-3,7-dihydropurin-2-one?
The canonical SMILES for 6-(dibutylamino)-3,7-dihydropurin-2-one is CCCCN(CCCC)c1nc(=O)[nH]c2nc[nH]c12.
What is the InChIKey of 6-(dibutylamino)-3,7-dihydropurin-2-one?
The InChIKey is XVOZQTYYESVLKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N5O/c1-3-5-7-18(8-6-4-2)12-10-11(15-9-14-10)16-13(19)17-12/h9H,3-8H2,1-2H3,(H2,14,15,16,17,19).
What are the key properties of 6-(dibutylamino)-3,7-dihydropurin-2-one?
6-(dibutylamino)-3,7-dihydropurin-2-one has a molecular weight of 263.34 g/mol, XLogP of 2.05, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dibutylamino)-3,7-dihydropurin-2-one is sourced from PubChem (CID 3631920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).