(2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate

C16H17ClO4 — CID 3632242

IUPAC(2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate
SMILESO=C(CCC(=O)c1ccc(Cl)cc1)OC1CCCCC1=O
InChIInChI=1S/C16H17ClO4/c17-12-7-5-11(6-8-12)13(18)9-10-16(20)21-15-4-2-1-3-14(15)19/h5-8,15H,1-4,9-10H2
InChIKeyPYFIQHDTLSPYCV-UHFFFAOYSA-N
MW308.76 g/mol
LogP3.36
Rot. Bonds5

About (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate

(2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate (PubChem CID 3632242) has the molecular formula C16H17ClO4 and a molecular weight of 308.76 g/mol. Its IUPAC name is (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate.

Molecular Properties

Compound Name(2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate
PubChem CID3632242
Molecular FormulaC16H17ClO4
Molecular Weight308.76 g/mol
Exact Mass308.08
IUPAC Name(2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate
SMILESO=C(CCC(=O)c1ccc(Cl)cc1)OC1CCCCC1=O
InChIInChI=1S/C16H17ClO4/c17-12-7-5-11(6-8-12)13(18)9-10-16(20)21-15-4-2-1-3-14(15)19/h5-8,15H,1-4,9-10H2
InChIKeyPYFIQHDTLSPYCV-UHFFFAOYSA-N
XLogP3.36
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.76
LogP ≤ 53.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate?
The IUPAC name of (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate (CID 3632242) is (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate.
What is the SMILES notation for (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate?
The canonical SMILES for (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate is O=C(CCC(=O)c1ccc(Cl)cc1)OC1CCCCC1=O.
What is the InChIKey of (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate?
The InChIKey is PYFIQHDTLSPYCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClO4/c17-12-7-5-11(6-8-12)13(18)9-10-16(20)21-15-4-2-1-3-14(15)19/h5-8,15H,1-4,9-10H2.
What are the key properties of (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate?
(2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate has a molecular weight of 308.76 g/mol, XLogP of 3.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate is sourced from PubChem (CID 3632242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).