About (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate
(2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate (PubChem CID 3632242) has the molecular formula C16H17ClO4
and a molecular weight of 308.76 g/mol. Its IUPAC name is (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate.
Molecular Properties
| Compound Name | (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate |
| PubChem CID | 3632242 |
| Molecular Formula | C16H17ClO4 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate |
| SMILES | O=C(CCC(=O)c1ccc(Cl)cc1)OC1CCCCC1=O |
| InChI | InChI=1S/C16H17ClO4/c17-12-7-5-11(6-8-12)13(18)9-10-16(20)21-15-4-2-1-3-14(15)19/h5-8,15H,1-4,9-10H2 |
| InChIKey | PYFIQHDTLSPYCV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate?
The IUPAC name of (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate (CID 3632242) is (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate.
What is the SMILES notation for (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate?
The canonical SMILES for (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate is O=C(CCC(=O)c1ccc(Cl)cc1)OC1CCCCC1=O.
What is the InChIKey of (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate?
The InChIKey is PYFIQHDTLSPYCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClO4/c17-12-7-5-11(6-8-12)13(18)9-10-16(20)21-15-4-2-1-3-14(15)19/h5-8,15H,1-4,9-10H2.
What are the key properties of (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate?
(2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate has a molecular weight of 308.76 g/mol, XLogP of 3.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxocyclohexyl) 4-(4-chlorophenyl)-4-oxobutanoate is sourced from PubChem (CID 3632242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).