About 2-[2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-5,7-dichloroquinolin-8-ol
2-[2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-5,7-dichloroquinolin-8-ol (PubChem CID 3632615) has the molecular formula C14H8BrCl2N3OS
and a molecular weight of 417.12 g/mol. Its IUPAC name is 2-[2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-5,7-dichloroquinolin-8-ol.
Molecular Properties
| Compound Name | 2-[2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-5,7-dichloroquinolin-8-ol |
| PubChem CID | 3632615 |
| Molecular Formula | C14H8BrCl2N3OS |
| Molecular Weight | 417.12 g/mol |
| Exact Mass | 414.89 |
| IUPAC Name | 2-[2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-5,7-dichloroquinolin-8-ol |
| SMILES | Oc1c(Cl)cc(Cl)c2ccc(NN=Cc3cc(Br)cs3)nc12 |
| InChI | InChI=1S/C14H8BrCl2N3OS/c15-7-3-8(22-6-7)5-18-20-12-2-1-9-10(16)4-11(17)14(21)13(9)19-12/h1-6,21H,(H,19,20) |
| InChIKey | QNAJVKAABMAMMQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.12 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-5,7-dichloroquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-5,7-dichloroquinolin-8-ol?
The IUPAC name of 2-[2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-5,7-dichloroquinolin-8-ol (CID 3632615) is 2-[2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-5,7-dichloroquinolin-8-ol.
What is the SMILES notation for 2-[2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-5,7-dichloroquinolin-8-ol?
The canonical SMILES for 2-[2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-5,7-dichloroquinolin-8-ol is Oc1c(Cl)cc(Cl)c2ccc(NN=Cc3cc(Br)cs3)nc12.
What is the InChIKey of 2-[2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-5,7-dichloroquinolin-8-ol?
The InChIKey is QNAJVKAABMAMMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BrCl2N3OS/c15-7-3-8(22-6-7)5-18-20-12-2-1-9-10(16)4-11(17)14(21)13(9)19-12/h1-6,21H,(H,19,20).
What are the key properties of 2-[2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-5,7-dichloroquinolin-8-ol?
2-[2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-5,7-dichloroquinolin-8-ol has a molecular weight of 417.12 g/mol, XLogP of 5.52, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(4-bromothiophen-2-yl)methylidene]hydrazinyl]-5,7-dichloroquinolin-8-ol is sourced from PubChem (CID 3632615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).