About methyl 4-amino-3-(2,4-difluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxylate
methyl 4-amino-3-(2,4-difluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxylate (PubChem CID 3633349) has the molecular formula C11H8F2N2O2S2
and a molecular weight of 302.33 g/mol. Its IUPAC name is methyl 4-amino-3-(2,4-difluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 4-amino-3-(2,4-difluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxylate |
| PubChem CID | 3633349 |
| Molecular Formula | C11H8F2N2O2S2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | methyl 4-amino-3-(2,4-difluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(=S)n(-c2ccc(F)cc2F)c1N |
| InChI | InChI=1S/C11H8F2N2O2S2/c1-17-10(16)8-9(14)15(11(18)19-8)7-3-2-5(12)4-6(7)13/h2-4H,14H2,1H3 |
| InChIKey | VYPHYPFZPWGGDT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-amino-3-(2,4-difluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-3-(2,4-difluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxylate?
The IUPAC name of methyl 4-amino-3-(2,4-difluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxylate (CID 3633349) is methyl 4-amino-3-(2,4-difluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxylate.
What is the SMILES notation for methyl 4-amino-3-(2,4-difluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxylate?
The canonical SMILES for methyl 4-amino-3-(2,4-difluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxylate is COC(=O)c1sc(=S)n(-c2ccc(F)cc2F)c1N.
What is the InChIKey of methyl 4-amino-3-(2,4-difluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxylate?
The InChIKey is VYPHYPFZPWGGDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F2N2O2S2/c1-17-10(16)8-9(14)15(11(18)19-8)7-3-2-5(12)4-6(7)13/h2-4H,14H2,1H3.
What are the key properties of methyl 4-amino-3-(2,4-difluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxylate?
methyl 4-amino-3-(2,4-difluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxylate has a molecular weight of 302.33 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-3-(2,4-difluorophenyl)-2-sulfanylidene-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 3633349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).