C26H33N3O5S2 — CID 3633502
ethyl 2-[2-[4-(dibutylsulfamoyl)benzoyl]imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 3633502) has the molecular formula C26H33N3O5S2 and a molecular weight of 531.70 g/mol. Its IUPAC name is ethyl 2-[2-[4-(dibutylsulfamoyl)benzoyl]imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-[4-(dibutylsulfamoyl)benzoyl]imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 3633502 |
| Molecular Formula | C26H33N3O5S2 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | ethyl 2-[2-[4-(dibutylsulfamoyl)benzoyl]imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3ccccc3n2CC(=O)OCC)cc1 |
| InChI | InChI=1S/C26H33N3O5S2/c1-4-7-17-28(18-8-5-2)36(32,33)21-15-13-20(14-16-21)25(31)27-26-29(19-24(30)34-6-3)22-11-9-10-12-23(22)35-26/h9-16H,4-8,17-19H2,1-3H3/b27-26- |
| InChIKey | XCILLDDFVPWODK-RQZHXJHFSA-N |
| XLogP | 4.60 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |