C32H29N5O5 — CID 3634006
12-(4-pyridin-2-ylpiperazin-1-yl)-10-(3,4,5-trimethoxyanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 3634006) has the molecular formula C32H29N5O5 and a molecular weight of 563.61 g/mol. Its IUPAC name is 12-(4-pyridin-2-ylpiperazin-1-yl)-10-(3,4,5-trimethoxyanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 12-(4-pyridin-2-ylpiperazin-1-yl)-10-(3,4,5-trimethoxyanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 3634006 |
| Molecular Formula | C32H29N5O5 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 12-(4-pyridin-2-ylpiperazin-1-yl)-10-(3,4,5-trimethoxyanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | COc1cc(Nc2cc(N3CCN(c4ccccn4)CC3)c3noc4c3c2C(=O)c2ccccc2-4)cc(OC)c1OC |
| InChI | InChI=1S/C32H29N5O5/c1-39-24-16-19(17-25(40-2)32(24)41-3)34-22-18-23(36-12-14-37(15-13-36)26-10-6-7-11-33-26)29-28-27(22)30(38)20-8-4-5-9-21(20)31(28)42-35-29/h4-11,16-18,34H,12-15H2,1-3H3 |
| InChIKey | BIVGAQIOSAGXSA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|