C33H22BrN5O2S — CID 3634356
4'-(4-bromophenyl)-5-(4-nitrophenyl)-2',3-diphenylspiro[1,3,4-thiadiazole-2,1'-phthalazine] (PubChem CID 3634356) has the molecular formula C33H22BrN5O2S and a molecular weight of 632.54 g/mol. Its IUPAC name is 4'-(4-bromophenyl)-5-(4-nitrophenyl)-2',3-diphenylspiro[1,3,4-thiadiazole-2,1'-phthalazine].
| Compound Name | 4'-(4-bromophenyl)-5-(4-nitrophenyl)-2',3-diphenylspiro[1,3,4-thiadiazole-2,1'-phthalazine] |
|---|---|
| PubChem CID | 3634356 |
| Molecular Formula | C33H22BrN5O2S |
| Molecular Weight | 632.54 g/mol |
| Exact Mass | 631.07 |
| IUPAC Name | 4'-(4-bromophenyl)-5-(4-nitrophenyl)-2',3-diphenylspiro[1,3,4-thiadiazole-2,1'-phthalazine] |
| SMILES | O=[N+]([O-])c1ccc(C2=NN(c3ccccc3)C3(S2)c2ccccc2C(c2ccc(Br)cc2)=NN3c2ccccc2)cc1 |
| InChI | InChI=1S/C33H22BrN5O2S/c34-25-19-15-23(16-20-25)31-29-13-7-8-14-30(29)33(37(35-31)26-9-3-1-4-10-26)38(27-11-5-2-6-12-27)36-32(42-33)24-17-21-28(22-18-24)39(40)41/h1-22H |
| InChIKey | ZTUUNUDRSMHZMK-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 74.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.54 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|