C22H17ClN2O5 — CID 3634766
4-[[5-(4-chloro-2,5-dimethoxyphenyl)furan-2-yl]methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 3634766) has the molecular formula C22H17ClN2O5 and a molecular weight of 424.84 g/mol. Its IUPAC name is 4-[[5-(4-chloro-2,5-dimethoxyphenyl)furan-2-yl]methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | 4-[[5-(4-chloro-2,5-dimethoxyphenyl)furan-2-yl]methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 3634766 |
| Molecular Formula | C22H17ClN2O5 |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 4-[[5-(4-chloro-2,5-dimethoxyphenyl)furan-2-yl]methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | COc1cc(-c2ccc(C=C3C(=O)NN(c4ccccc4)C3=O)o2)c(OC)cc1Cl |
| InChI | InChI=1S/C22H17ClN2O5/c1-28-19-12-17(23)20(29-2)11-15(19)18-9-8-14(30-18)10-16-21(26)24-25(22(16)27)13-6-4-3-5-7-13/h3-12H,1-2H3,(H,24,26) |
| InChIKey | SHWLZFPRTZPPQJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|