C31H20N2O4 — CID 3635002
N-(9,10-dioxoanthracen-1-yl)-2-(4-methoxyphenyl)quinoline-4-carboxamide (PubChem CID 3635002) has the molecular formula C31H20N2O4 and a molecular weight of 484.51 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-2-(4-methoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-2-(4-methoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3635002 |
| Molecular Formula | C31H20N2O4 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-2-(4-methoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3cccc4c3C(=O)c3ccccc3C4=O)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C31H20N2O4/c1-37-19-15-13-18(14-16-19)27-17-24(20-7-4-5-11-25(20)32-27)31(36)33-26-12-6-10-23-28(26)30(35)22-9-3-2-8-21(22)29(23)34/h2-17H,1H3,(H,33,36) |
| InChIKey | PNPZNZWIZWGRTQ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|