C12H25N3O3S — CID 3636220
N-[2-(dimethylamino)ethyl]-1-ethylsulfonylpiperidine-4-carboxamide (PubChem CID 3636220) has the molecular formula C12H25N3O3S and a molecular weight of 291.42 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-1-ethylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-1-ethylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3636220 |
| Molecular Formula | C12H25N3O3S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-1-ethylsulfonylpiperidine-4-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)NCCN(C)C)CC1 |
| InChI | InChI=1S/C12H25N3O3S/c1-4-19(17,18)15-8-5-11(6-9-15)12(16)13-7-10-14(2)3/h11H,4-10H2,1-3H3,(H,13,16) |
| InChIKey | CAPCSHDFAQHSGJ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |