C20H26N4O — CID 3636327
N-[(4-tert-butylcyclohexylidene)amino]-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 3636327) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is N-[(4-tert-butylcyclohexylidene)amino]-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(4-tert-butylcyclohexylidene)amino]-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3636327 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | N-[(4-tert-butylcyclohexylidene)amino]-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | CC(C)(C)C1CCC(=NNC(=O)c2cc(-c3ccccc3)n[nH]2)CC1 |
| InChI | InChI=1S/C20H26N4O/c1-20(2,3)15-9-11-16(12-10-15)21-24-19(25)18-13-17(22-23-18)14-7-5-4-6-8-14/h4-8,13,15H,9-12H2,1-3H3,(H,22,23)(H,24,25)/b21-16- |
| InChIKey | ZGICVJUUWOLJRI-PGMHBOJBSA-N |
| XLogP | 4.40 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|