About phthalazin-1-ylhydrazine
phthalazin-1-ylhydrazine (PubChem CID 3637) has the molecular formula C8H8N4
and a molecular weight of 160.18 g/mol. Its IUPAC name is phthalazin-1-ylhydrazine.
Molecular Properties
| Compound Name | phthalazin-1-ylhydrazine |
| PubChem CID | 3637 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | phthalazin-1-ylhydrazine |
| SMILES | NNc1nncc2ccccc12 |
| InChI | InChI=1S/C8H8N4/c9-11-8-7-4-2-1-3-6(7)5-10-12-8/h1-5H,9H2,(H,11,12) |
| InChIKey | RPTUSVTUFVMDQK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze phthalazin-1-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phthalazin-1-ylhydrazine?
The IUPAC name of phthalazin-1-ylhydrazine (CID 3637) is phthalazin-1-ylhydrazine.
What is the SMILES notation for phthalazin-1-ylhydrazine?
The canonical SMILES for phthalazin-1-ylhydrazine is NNc1nncc2ccccc12.
What is the InChIKey of phthalazin-1-ylhydrazine?
The InChIKey is RPTUSVTUFVMDQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4/c9-11-8-7-4-2-1-3-6(7)5-10-12-8/h1-5H,9H2,(H,11,12).
What are the key properties of phthalazin-1-ylhydrazine?
phthalazin-1-ylhydrazine has a molecular weight of 160.18 g/mol, XLogP of 0.92, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phthalazin-1-ylhydrazine is sourced from PubChem (CID 3637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).