C15H10N4O6 — CID 3637324
5-(2,4-dioxo-1,5-dihydrochromeno[2,3-d]pyrimidin-5-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 3637324) has the molecular formula C15H10N4O6 and a molecular weight of 342.27 g/mol. Its IUPAC name is 5-(2,4-dioxo-1,5-dihydrochromeno[2,3-d]pyrimidin-5-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(2,4-dioxo-1,5-dihydrochromeno[2,3-d]pyrimidin-5-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3637324 |
| Molecular Formula | C15H10N4O6 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 5-(2,4-dioxo-1,5-dihydrochromeno[2,3-d]pyrimidin-5-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(C2c3ccccc3Oc3[nH]c(=O)[nH]c(=O)c32)C(=O)N1 |
| InChI | InChI=1S/C15H10N4O6/c20-10-8(11(21)17-14(23)16-10)7-5-3-1-2-4-6(5)25-13-9(7)12(22)18-15(24)19-13/h1-4,7-8H,(H2,18,19,22,24)(H2,16,17,20,21,23) |
| InChIKey | TYOASCKTVMEBDL-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 150.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|