About 5,7-difluoro-2-pyridin-2-yl-2,3-dihydro-1H-indole
5,7-difluoro-2-pyridin-2-yl-2,3-dihydro-1H-indole (PubChem CID 3637452) has the molecular formula C13H10F2N2
and a molecular weight of 232.23 g/mol. Its IUPAC name is 5,7-difluoro-2-pyridin-2-yl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 5,7-difluoro-2-pyridin-2-yl-2,3-dihydro-1H-indole |
| PubChem CID | 3637452 |
| Molecular Formula | C13H10F2N2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 5,7-difluoro-2-pyridin-2-yl-2,3-dihydro-1H-indole |
| SMILES | Fc1cc(F)c2c(c1)CC(c1ccccn1)N2 |
| InChI | InChI=1S/C13H10F2N2/c14-9-5-8-6-12(11-3-1-2-4-16-11)17-13(8)10(15)7-9/h1-5,7,12,17H,6H2 |
| InChIKey | FALYMZOMGOYYFX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-difluoro-2-pyridin-2-yl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-difluoro-2-pyridin-2-yl-2,3-dihydro-1H-indole?
The IUPAC name of 5,7-difluoro-2-pyridin-2-yl-2,3-dihydro-1H-indole (CID 3637452) is 5,7-difluoro-2-pyridin-2-yl-2,3-dihydro-1H-indole.
What is the SMILES notation for 5,7-difluoro-2-pyridin-2-yl-2,3-dihydro-1H-indole?
The canonical SMILES for 5,7-difluoro-2-pyridin-2-yl-2,3-dihydro-1H-indole is Fc1cc(F)c2c(c1)CC(c1ccccn1)N2.
What is the InChIKey of 5,7-difluoro-2-pyridin-2-yl-2,3-dihydro-1H-indole?
The InChIKey is FALYMZOMGOYYFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F2N2/c14-9-5-8-6-12(11-3-1-2-4-16-11)17-13(8)10(15)7-9/h1-5,7,12,17H,6H2.
What are the key properties of 5,7-difluoro-2-pyridin-2-yl-2,3-dihydro-1H-indole?
5,7-difluoro-2-pyridin-2-yl-2,3-dihydro-1H-indole has a molecular weight of 232.23 g/mol, XLogP of 3.07, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-difluoro-2-pyridin-2-yl-2,3-dihydro-1H-indole is sourced from PubChem (CID 3637452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).