About (9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-phenylmethanone
(9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-phenylmethanone (PubChem CID 3637684) has the molecular formula C20H15NO3S
and a molecular weight of 349.41 g/mol. Its IUPAC name is (9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-phenylmethanone |
| PubChem CID | 3637684 |
| Molecular Formula | C20H15NO3S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | (9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-phenylmethanone |
| SMILES | Cc1ccc2c(c1)-c1ccccc1S(=O)(=O)N2C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H15NO3S/c1-14-11-12-18-17(13-14)16-9-5-6-10-19(16)25(23,24)21(18)20(22)15-7-3-2-4-8-15/h2-13H,1H3 |
| InChIKey | KWEHHERKCDYBLC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-phenylmethanone?
The IUPAC name of (9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-phenylmethanone (CID 3637684) is (9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-phenylmethanone.
What is the SMILES notation for (9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-phenylmethanone?
The canonical SMILES for (9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-phenylmethanone is Cc1ccc2c(c1)-c1ccccc1S(=O)(=O)N2C(=O)c1ccccc1.
What is the InChIKey of (9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-phenylmethanone?
The InChIKey is KWEHHERKCDYBLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15NO3S/c1-14-11-12-18-17(13-14)16-9-5-6-10-19(16)25(23,24)21(18)20(22)15-7-3-2-4-8-15/h2-13H,1H3.
What are the key properties of (9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-phenylmethanone?
(9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-phenylmethanone has a molecular weight of 349.41 g/mol, XLogP of 4.01, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9-methyl-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-phenylmethanone is sourced from PubChem (CID 3637684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).