C19H16F7N3 — CID 3637923
5-tert-butyl-7-(1,1,2,2,3,3,3-heptafluoropropyl)-2-phenylpyrazolo[1,5-a]pyrimidine (PubChem CID 3637923) has the molecular formula C19H16F7N3 and a molecular weight of 419.34 g/mol. Its IUPAC name is 5-tert-butyl-7-(1,1,2,2,3,3,3-heptafluoropropyl)-2-phenylpyrazolo[1,5-a]pyrimidine.
| Compound Name | 5-tert-butyl-7-(1,1,2,2,3,3,3-heptafluoropropyl)-2-phenylpyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 3637923 |
| Molecular Formula | C19H16F7N3 |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 5-tert-butyl-7-(1,1,2,2,3,3,3-heptafluoropropyl)-2-phenylpyrazolo[1,5-a]pyrimidine |
| SMILES | CC(C)(C)c1cc(C(F)(F)C(F)(F)C(F)(F)F)n2nc(-c3ccccc3)cc2n1 |
| InChI | InChI=1S/C19H16F7N3/c1-16(2,3)13-10-14(17(20,21)18(22,23)19(24,25)26)29-15(27-13)9-12(28-29)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| InChIKey | RNWIQELODLHLDL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|