C16H8Cl4N2O5S — CID 3638143
N-[4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)phenyl]sulfonylacetamide (PubChem CID 3638143) has the molecular formula C16H8Cl4N2O5S and a molecular weight of 482.13 g/mol. Its IUPAC name is N-[4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)phenyl]sulfonylacetamide.
| Compound Name | N-[4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 3638143 |
| Molecular Formula | C16H8Cl4N2O5S |
| Molecular Weight | 482.13 g/mol |
| Exact Mass | 479.89 |
| IUPAC Name | N-[4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(N2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)cc1 |
| InChI | InChI=1S/C16H8Cl4N2O5S/c1-6(23)21-28(26,27)8-4-2-7(3-5-8)22-15(24)9-10(16(22)25)12(18)14(20)13(19)11(9)17/h2-5H,1H3,(H,21,23) |
| InChIKey | IPXJGIJBKOGWFG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.13 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|