C38H45ClF3NO6S — CID 3638302
N-[[17-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carbonyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylmethanesulfonamide (PubChem CID 3638302) has the molecular formula C38H45ClF3NO6S and a molecular weight of 736.29 g/mol. Its IUPAC name is N-[[17-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carbonyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylmethanesulfonamide.
| Compound Name | N-[[17-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carbonyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylmethanesulfonamide |
|---|---|
| PubChem CID | 3638302 |
| Molecular Formula | C38H45ClF3NO6S |
| Molecular Weight | 736.29 g/mol |
| Exact Mass | 735.26 |
| IUPAC Name | N-[[17-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-carbonyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylmethanesulfonamide |
| SMILES | CCCN(CC1(O)CCC2c3ccc(cc3C(=O)c3ccc(-c4cc(C(F)(F)F)ccc4Cl)o3)CC(O)CCC(C)=CCCC21C)S(C)(=O)=O |
| InChI | InChI=1S/C38H45ClF3NO6S/c1-5-19-43(50(4,47)48)23-37(46)18-16-31-28-12-9-25(20-27(44)11-8-24(2)7-6-17-36(31,37)3)21-29(28)35(45)34-15-14-33(49-34)30-22-26(38(40,41)42)10-13-32(30)39/h7,9-10,12-15,21-22,27,31,44,46H,5-6,8,11,16-20,23H2,1-4H3 |
| InChIKey | IJEKPHOHHFJYOF-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.29 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|