C34H45ClFNO5S — CID 3638303
N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylmethanesulfonamide (PubChem CID 3638303) has the molecular formula C34H45ClFNO5S and a molecular weight of 634.25 g/mol. Its IUPAC name is N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylmethanesulfonamide.
| Compound Name | N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylmethanesulfonamide |
|---|---|
| PubChem CID | 3638303 |
| Molecular Formula | C34H45ClFNO5S |
| Molecular Weight | 634.25 g/mol |
| Exact Mass | 633.27 |
| IUPAC Name | N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylmethanesulfonamide |
| SMILES | CCCN(CC1(O)CCC2c3ccc(cc3C(=O)Cc3c(F)cccc3Cl)CC(O)CCC(C)=CCCC21C)S(C)(=O)=O |
| InChI | InChI=1S/C34H45ClFNO5S/c1-5-18-37(43(4,41)42)22-34(40)17-15-29-26-14-12-24(19-25(38)13-11-23(2)8-7-16-33(29,34)3)20-27(26)32(39)21-28-30(35)9-6-10-31(28)36/h6,8-10,12,14,20,25,29,38,40H,5,7,11,13,15-19,21-22H2,1-4H3 |
| InChIKey | XTHIUUCAKQXMSF-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.25 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|