C10H9Cl2N6O+ — CID 3638639
[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2,6-dichlorophenyl)methylidene]azanium (PubChem CID 3638639) has the molecular formula C10H9Cl2N6O+ and a molecular weight of 300.13 g/mol. Its IUPAC name is [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2,6-dichlorophenyl)methylidene]azanium.
| Compound Name | [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2,6-dichlorophenyl)methylidene]azanium |
|---|---|
| PubChem CID | 3638639 |
| Molecular Formula | C10H9Cl2N6O+ |
| Molecular Weight | 300.13 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino]-[(2,6-dichlorophenyl)methylidene]azanium |
| SMILES | NC(=N[NH+]=Cc1c(Cl)cccc1Cl)c1nonc1N |
| InChI | InChI=1S/C10H8Cl2N6O/c11-6-2-1-3-7(12)5(6)4-15-16-9(13)8-10(14)18-19-17-8/h1-4H,(H2,13,16)(H2,14,18)/p+1 |
| InChIKey | FSXONGLVCTVNHG-UHFFFAOYSA-O |
| XLogP | -0.22 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.13 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|