C7H8ClN3O4S2 — CID 3639
View drug profile → hydrochlorothiazide6-chloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide (PubChem CID 3639) has the molecular formula C7H8ClN3O4S2 and a molecular weight of 297.75 g/mol. Its IUPAC name is 6-chloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide.
| Compound Name | 6-chloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| PubChem CID | 3639 |
| Molecular Formula | C7H8ClN3O4S2 |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | 6-chloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
| SMILES | NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O |
| InChI | InChI=1S/C7H8ClN3O4S2/c8-4-1-5-7(2-6(4)16(9,12)13)17(14,15)11-3-10-5/h1-2,10-11H,3H2,(H2,9,12,13) |
| InChIKey | JZUFKLXOESDKRF-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |