C33H27FN4O4 — CID 3640038
ethyl 3-[[12-[4-(4-fluorophenyl)piperazin-1-yl]-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate (PubChem CID 3640038) has the molecular formula C33H27FN4O4 and a molecular weight of 562.60 g/mol. Its IUPAC name is ethyl 3-[[12-[4-(4-fluorophenyl)piperazin-1-yl]-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate.
| Compound Name | ethyl 3-[[12-[4-(4-fluorophenyl)piperazin-1-yl]-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate |
|---|---|
| PubChem CID | 3640038 |
| Molecular Formula | C33H27FN4O4 |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | ethyl 3-[[12-[4-(4-fluorophenyl)piperazin-1-yl]-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2cc(N3CCN(c4ccc(F)cc4)CC3)c3noc4c3c2C(=O)c2ccccc2-4)c1 |
| InChI | InChI=1S/C33H27FN4O4/c1-2-41-33(40)20-6-5-7-22(18-20)35-26-19-27(38-16-14-37(15-17-38)23-12-10-21(34)11-13-23)30-29-28(26)31(39)24-8-3-4-9-25(24)32(29)42-36-30/h3-13,18-19,35H,2,14-17H2,1H3 |
| InChIKey | HRZUHURXQAHCKJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|