About (2-anilino-2-oxoethyl) 2-(4-phenylpiperazine-1-carbonyl)benzoate
(2-anilino-2-oxoethyl) 2-(4-phenylpiperazine-1-carbonyl)benzoate (PubChem CID 3640317) has the molecular formula C26H25N3O4
and a molecular weight of 443.50 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 2-(4-phenylpiperazine-1-carbonyl)benzoate.
Molecular Properties
| Compound Name | (2-anilino-2-oxoethyl) 2-(4-phenylpiperazine-1-carbonyl)benzoate |
| PubChem CID | 3640317 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (2-anilino-2-oxoethyl) 2-(4-phenylpiperazine-1-carbonyl)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1C(=O)N1CCN(c2ccccc2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C26H25N3O4/c30-24(27-20-9-3-1-4-10-20)19-33-26(32)23-14-8-7-13-22(23)25(31)29-17-15-28(16-18-29)21-11-5-2-6-12-21/h1-14H,15-19H2,(H,27,30) |
| InChIKey | OVEVHIGAOCDINP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-anilino-2-oxoethyl) 2-(4-phenylpiperazine-1-carbonyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-anilino-2-oxoethyl) 2-(4-phenylpiperazine-1-carbonyl)benzoate?
The IUPAC name of (2-anilino-2-oxoethyl) 2-(4-phenylpiperazine-1-carbonyl)benzoate (CID 3640317) is (2-anilino-2-oxoethyl) 2-(4-phenylpiperazine-1-carbonyl)benzoate.
What is the SMILES notation for (2-anilino-2-oxoethyl) 2-(4-phenylpiperazine-1-carbonyl)benzoate?
The canonical SMILES for (2-anilino-2-oxoethyl) 2-(4-phenylpiperazine-1-carbonyl)benzoate is O=C(COC(=O)c1ccccc1C(=O)N1CCN(c2ccccc2)CC1)Nc1ccccc1.
What is the InChIKey of (2-anilino-2-oxoethyl) 2-(4-phenylpiperazine-1-carbonyl)benzoate?
The InChIKey is OVEVHIGAOCDINP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25N3O4/c30-24(27-20-9-3-1-4-10-20)19-33-26(32)23-14-8-7-13-22(23)25(31)29-17-15-28(16-18-29)21-11-5-2-6-12-21/h1-14H,15-19H2,(H,27,30).
What are the key properties of (2-anilino-2-oxoethyl) 2-(4-phenylpiperazine-1-carbonyl)benzoate?
(2-anilino-2-oxoethyl) 2-(4-phenylpiperazine-1-carbonyl)benzoate has a molecular weight of 443.50 g/mol, XLogP of 3.44, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-anilino-2-oxoethyl) 2-(4-phenylpiperazine-1-carbonyl)benzoate is sourced from PubChem (CID 3640317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).