C10H9N3O4S — CID 3640623
3-(1H-imidazol-5-ylsulfonylamino)benzoic acid (PubChem CID 3640623) has the molecular formula C10H9N3O4S and a molecular weight of 267.27 g/mol. Its IUPAC name is 3-(1H-imidazol-5-ylsulfonylamino)benzoic acid.
| Compound Name | 3-(1H-imidazol-5-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 3640623 |
| Molecular Formula | C10H9N3O4S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 3-(1H-imidazol-5-ylsulfonylamino)benzoic acid |
| SMILES | O=C(O)c1cccc(NS(=O)(=O)c2cnc[nH]2)c1 |
| InChI | InChI=1S/C10H9N3O4S/c14-10(15)7-2-1-3-8(4-7)13-18(16,17)9-5-11-6-12-9/h1-6,13H,(H,11,12)(H,14,15) |
| InChIKey | GSQKMTIARWVONA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |