About tris(diethylamino)-(1,4-dihydroxynaphthalen-2-yl)phosphanium
tris(diethylamino)-(1,4-dihydroxynaphthalen-2-yl)phosphanium (PubChem CID 3640954) has the molecular formula C22H37N3O2P+
and a molecular weight of 406.53 g/mol. Its IUPAC name is tris(diethylamino)-(1,4-dihydroxynaphthalen-2-yl)phosphanium.
Molecular Properties
| Compound Name | tris(diethylamino)-(1,4-dihydroxynaphthalen-2-yl)phosphanium |
| PubChem CID | 3640954 |
| Molecular Formula | C22H37N3O2P+ |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | tris(diethylamino)-(1,4-dihydroxynaphthalen-2-yl)phosphanium |
| SMILES | CCN(CC)[P+](c1cc(O)c2ccccc2c1O)(N(CC)CC)N(CC)CC |
| InChI | InChI=1S/C22H36N3O2P/c1-7-23(8-2)28(24(9-3)10-4,25(11-5)12-6)21-17-20(26)18-15-13-14-16-19(18)22(21)27/h13-17H,7-12H2,1-6H3,(H-,26,27)/p+1 |
| InChIKey | HPUYFCQLUQYTBN-UHFFFAOYSA-O |
| XLogP | 4.66 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris(diethylamino)-(1,4-dihydroxynaphthalen-2-yl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(diethylamino)-(1,4-dihydroxynaphthalen-2-yl)phosphanium?
The IUPAC name of tris(diethylamino)-(1,4-dihydroxynaphthalen-2-yl)phosphanium (CID 3640954) is tris(diethylamino)-(1,4-dihydroxynaphthalen-2-yl)phosphanium.
What is the SMILES notation for tris(diethylamino)-(1,4-dihydroxynaphthalen-2-yl)phosphanium?
The canonical SMILES for tris(diethylamino)-(1,4-dihydroxynaphthalen-2-yl)phosphanium is CCN(CC)[P+](c1cc(O)c2ccccc2c1O)(N(CC)CC)N(CC)CC.
What is the InChIKey of tris(diethylamino)-(1,4-dihydroxynaphthalen-2-yl)phosphanium?
The InChIKey is HPUYFCQLUQYTBN-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H36N3O2P/c1-7-23(8-2)28(24(9-3)10-4,25(11-5)12-6)21-17-20(26)18-15-13-14-16-19(18)22(21)27/h13-17H,7-12H2,1-6H3,(H-,26,27)/p+1.
What are the key properties of tris(diethylamino)-(1,4-dihydroxynaphthalen-2-yl)phosphanium?
tris(diethylamino)-(1,4-dihydroxynaphthalen-2-yl)phosphanium has a molecular weight of 406.53 g/mol, XLogP of 4.66, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tris(diethylamino)-(1,4-dihydroxynaphthalen-2-yl)phosphanium is sourced from PubChem (CID 3640954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).