C14H23ClN2O2S — CID 3640968
1-[8-(2-chloropropanoyl)-1-thia-4,8-diazaspiro[4.5]decan-4-yl]-2-methylpropan-1-one (PubChem CID 3640968) has the molecular formula C14H23ClN2O2S and a molecular weight of 318.87 g/mol. Its IUPAC name is 1-[8-(2-chloropropanoyl)-1-thia-4,8-diazaspiro[4.5]decan-4-yl]-2-methylpropan-1-one.
| Compound Name | 1-[8-(2-chloropropanoyl)-1-thia-4,8-diazaspiro[4.5]decan-4-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 3640968 |
| Molecular Formula | C14H23ClN2O2S |
| Molecular Weight | 318.87 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-[8-(2-chloropropanoyl)-1-thia-4,8-diazaspiro[4.5]decan-4-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCSC12CCN(C(=O)C(C)Cl)CC2 |
| InChI | InChI=1S/C14H23ClN2O2S/c1-10(2)12(18)17-8-9-20-14(17)4-6-16(7-5-14)13(19)11(3)15/h10-11H,4-9H2,1-3H3 |
| InChIKey | FTINCLOZEFLUDX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.87 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|