C20H19ClF3N5O2 — CID 3641430
3-[[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 3641430) has the molecular formula C20H19ClF3N5O2 and a molecular weight of 453.85 g/mol. Its IUPAC name is 3-[[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 3641430 |
| Molecular Formula | C20H19ClF3N5O2 |
| Molecular Weight | 453.85 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 3-[[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1nn(-c2cccc(C(F)(F)F)c2)c(Cl)c1C=NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C20H19ClF3N5O2/c1-12-15(11-25-29-17(30)19(26-18(29)31)8-3-2-4-9-19)16(21)28(27-12)14-7-5-6-13(10-14)20(22,23)24/h5-7,10-11H,2-4,8-9H2,1H3,(H,26,31) |
| InChIKey | YIFHHZZQIWPGEM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.85 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|