About 6-acetyl-4H-1,4-benzoxazin-3-one
6-acetyl-4H-1,4-benzoxazin-3-one (PubChem CID 3641956) has the molecular formula C10H9NO3
and a molecular weight of 191.19 g/mol. Its IUPAC name is 6-acetyl-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-acetyl-4H-1,4-benzoxazin-3-one |
| PubChem CID | 3641956 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 6-acetyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C10H9NO3/c1-6(12)7-2-3-9-8(4-7)11-10(13)5-14-9/h2-4H,5H2,1H3,(H,11,13) |
| InChIKey | BKJFWHFUERNXLJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-acetyl-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetyl-4H-1,4-benzoxazin-3-one?
The IUPAC name of 6-acetyl-4H-1,4-benzoxazin-3-one (CID 3641956) is 6-acetyl-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-acetyl-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 6-acetyl-4H-1,4-benzoxazin-3-one is CC(=O)c1ccc2c(c1)NC(=O)CO2.
What is the InChIKey of 6-acetyl-4H-1,4-benzoxazin-3-one?
The InChIKey is BKJFWHFUERNXLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3/c1-6(12)7-2-3-9-8(4-7)11-10(13)5-14-9/h2-4H,5H2,1H3,(H,11,13).
What are the key properties of 6-acetyl-4H-1,4-benzoxazin-3-one?
6-acetyl-4H-1,4-benzoxazin-3-one has a molecular weight of 191.19 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetyl-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 3641956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).