C24H24ClNO3S2 — CID 3642016
5-[[5-chloro-2-[3-(3,5-dimethylphenoxy)propoxy]phenyl]methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3642016) has the molecular formula C24H24ClNO3S2 and a molecular weight of 474.05 g/mol. Its IUPAC name is 5-[[5-chloro-2-[3-(3,5-dimethylphenoxy)propoxy]phenyl]methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[5-chloro-2-[3-(3,5-dimethylphenoxy)propoxy]phenyl]methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3642016 |
| Molecular Formula | C24H24ClNO3S2 |
| Molecular Weight | 474.05 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 5-[[5-chloro-2-[3-(3,5-dimethylphenoxy)propoxy]phenyl]methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(=Cc2cc(Cl)ccc2OCCCOc2cc(C)cc(C)c2)SC1=S |
| InChI | InChI=1S/C24H24ClNO3S2/c1-4-8-26-23(27)22(31-24(26)30)15-18-14-19(25)6-7-21(18)29-10-5-9-28-20-12-16(2)11-17(3)13-20/h4,6-7,11-15H,1,5,8-10H2,2-3H3 |
| InChIKey | JTEZBIQSMOBOOP-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.05 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|