C22H16N2O6 — CID 3642232
methyl 2'-amino-1-methyl-2,5'-dioxospiro[indole-3,4'-pyrano[3,2-c]chromene]-3'-carboxylate (PubChem CID 3642232) has the molecular formula C22H16N2O6 and a molecular weight of 404.38 g/mol. Its IUPAC name is methyl 2'-amino-1-methyl-2,5'-dioxospiro[indole-3,4'-pyrano[3,2-c]chromene]-3'-carboxylate.
| Compound Name | methyl 2'-amino-1-methyl-2,5'-dioxospiro[indole-3,4'-pyrano[3,2-c]chromene]-3'-carboxylate |
|---|---|
| PubChem CID | 3642232 |
| Molecular Formula | C22H16N2O6 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | methyl 2'-amino-1-methyl-2,5'-dioxospiro[indole-3,4'-pyrano[3,2-c]chromene]-3'-carboxylate |
| SMILES | COC(=O)C1=C(N)Oc2c(c(=O)oc3ccccc23)C12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C22H16N2O6/c1-24-13-9-5-4-8-12(13)22(21(24)27)15-17(30-18(23)16(22)19(25)28-2)11-7-3-6-10-14(11)29-20(15)26/h3-10H,23H2,1-2H3 |
| InChIKey | BUJTWSCEMZNHOD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|