About (1-hydroxycyclopentyl) sulfite
(1-hydroxycyclopentyl) sulfite (PubChem CID 3642514) has the molecular formula C5H9O4S-
and a molecular weight of 165.19 g/mol. Its IUPAC name is (1-hydroxycyclopentyl) sulfite.
Molecular Properties
| Compound Name | (1-hydroxycyclopentyl) sulfite |
| PubChem CID | 3642514 |
| Molecular Formula | C5H9O4S- |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | (1-hydroxycyclopentyl) sulfite |
| SMILES | O=S([O-])OC1(O)CCCC1 |
| InChI | InChI=1S/C5H10O4S/c6-5(9-10(7)8)3-1-2-4-5/h6H,1-4H2,(H,7,8)/p-1 |
| InChIKey | CZCYGBBFJKJTPD-UHFFFAOYSA-M |
| XLogP | 0.06 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (1-hydroxycyclopentyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-hydroxycyclopentyl) sulfite?
The IUPAC name of (1-hydroxycyclopentyl) sulfite (CID 3642514) is (1-hydroxycyclopentyl) sulfite.
What is the SMILES notation for (1-hydroxycyclopentyl) sulfite?
The canonical SMILES for (1-hydroxycyclopentyl) sulfite is O=S([O-])OC1(O)CCCC1.
What is the InChIKey of (1-hydroxycyclopentyl) sulfite?
The InChIKey is CZCYGBBFJKJTPD-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10O4S/c6-5(9-10(7)8)3-1-2-4-5/h6H,1-4H2,(H,7,8)/p-1.
What are the key properties of (1-hydroxycyclopentyl) sulfite?
(1-hydroxycyclopentyl) sulfite has a molecular weight of 165.19 g/mol, XLogP of 0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-hydroxycyclopentyl) sulfite is sourced from PubChem (CID 3642514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).