C17H15FN2O2S — CID 3643648
ethyl 2-[(3-fluorophenyl)methylsulfanyl]benzimidazole-1-carboxylate (PubChem CID 3643648) has the molecular formula C17H15FN2O2S and a molecular weight of 330.38 g/mol. Its IUPAC name is ethyl 2-[(3-fluorophenyl)methylsulfanyl]benzimidazole-1-carboxylate.
| Compound Name | ethyl 2-[(3-fluorophenyl)methylsulfanyl]benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 3643648 |
| Molecular Formula | C17H15FN2O2S |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | ethyl 2-[(3-fluorophenyl)methylsulfanyl]benzimidazole-1-carboxylate |
| SMILES | CCOC(=O)n1c(SCc2cccc(F)c2)nc2ccccc21 |
| InChI | InChI=1S/C17H15FN2O2S/c1-2-22-17(21)20-15-9-4-3-8-14(15)19-16(20)23-11-12-6-5-7-13(18)10-12/h3-10H,2,11H2,1H3 |
| InChIKey | ZDRDOESTJWKDAS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |