C16H13N3O2S — CID 3643744
5'-(2-hydroxyphenyl)-5-methylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one (PubChem CID 3643744) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is 5'-(2-hydroxyphenyl)-5-methylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one.
| Compound Name | 5'-(2-hydroxyphenyl)-5-methylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one |
|---|---|
| PubChem CID | 3643744 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 5'-(2-hydroxyphenyl)-5-methylspiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one |
| SMILES | Cc1ccc2c(c1)C1(NN=C(c3ccccc3O)S1)C(=O)N2 |
| InChI | InChI=1S/C16H13N3O2S/c1-9-6-7-12-11(8-9)16(15(21)17-12)19-18-14(22-16)10-4-2-3-5-13(10)20/h2-8,19-20H,1H3,(H,17,21) |
| InChIKey | HTCWKYRNASAXQU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'het_thio_5_B(2)', 'substructure': 'N/A'} |
|---|