C26H26N4O4S2 — CID 3644357
N-[(2-methylphenyl)carbamothioyl]-2-[4-[2-[(2-methylphenyl)carbamothioylamino]-2-oxoethoxy]phenoxy]acetamide (PubChem CID 3644357) has the molecular formula C26H26N4O4S2 and a molecular weight of 522.65 g/mol. Its IUPAC name is N-[(2-methylphenyl)carbamothioyl]-2-[4-[2-[(2-methylphenyl)carbamothioylamino]-2-oxoethoxy]phenoxy]acetamide.
| Compound Name | N-[(2-methylphenyl)carbamothioyl]-2-[4-[2-[(2-methylphenyl)carbamothioylamino]-2-oxoethoxy]phenoxy]acetamide |
|---|---|
| PubChem CID | 3644357 |
| Molecular Formula | C26H26N4O4S2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | N-[(2-methylphenyl)carbamothioyl]-2-[4-[2-[(2-methylphenyl)carbamothioylamino]-2-oxoethoxy]phenoxy]acetamide |
| SMILES | Cc1ccccc1NC(=S)NC(=O)COc1ccc(OCC(=O)NC(=S)Nc2ccccc2C)cc1 |
| InChI | InChI=1S/C26H26N4O4S2/c1-17-7-3-5-9-21(17)27-25(35)29-23(31)15-33-19-11-13-20(14-12-19)34-16-24(32)30-26(36)28-22-10-6-4-8-18(22)2/h3-14H,15-16H2,1-2H3,(H2,27,29,31,35)(H2,28,30,32,36) |
| InChIKey | WMDBUWONHZKNGQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|