C29H18F6O4 — CID 3644621
[4-[2-(4-benzoyloxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] benzoate (PubChem CID 3644621) has the molecular formula C29H18F6O4 and a molecular weight of 544.45 g/mol. Its IUPAC name is [4-[2-(4-benzoyloxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] benzoate.
| Compound Name | [4-[2-(4-benzoyloxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 3644621 |
| Molecular Formula | C29H18F6O4 |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | [4-[2-(4-benzoyloxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] benzoate |
| SMILES | O=C(Oc1ccc(C(c2ccc(OC(=O)c3ccccc3)cc2)(C(F)(F)F)C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H18F6O4/c30-28(31,32)27(29(33,34)35,21-11-15-23(16-12-21)38-25(36)19-7-3-1-4-8-19)22-13-17-24(18-14-22)39-26(37)20-9-5-2-6-10-20/h1-18H |
| InChIKey | YJPGUPOLBXHEJZ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|