About N-[(3,5-dichloro-2-methoxyphenyl)-[1-(3-methylphenyl)tetrazol-5-yl]methyl]ethanamine
N-[(3,5-dichloro-2-methoxyphenyl)-[1-(3-methylphenyl)tetrazol-5-yl]methyl]ethanamine (PubChem CID 3644624) has the molecular formula C18H19Cl2N5O
and a molecular weight of 392.29 g/mol. Its IUPAC name is N-[(3,5-dichloro-2-methoxyphenyl)-[1-(3-methylphenyl)tetrazol-5-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[(3,5-dichloro-2-methoxyphenyl)-[1-(3-methylphenyl)tetrazol-5-yl]methyl]ethanamine |
| PubChem CID | 3644624 |
| Molecular Formula | C18H19Cl2N5O |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[(3,5-dichloro-2-methoxyphenyl)-[1-(3-methylphenyl)tetrazol-5-yl]methyl]ethanamine |
| SMILES | CCNC(c1cc(Cl)cc(Cl)c1OC)c1nnnn1-c1cccc(C)c1 |
| InChI | InChI=1S/C18H19Cl2N5O/c1-4-21-16(14-9-12(19)10-15(20)17(14)26-3)18-22-23-24-25(18)13-7-5-6-11(2)8-13/h5-10,16,21H,4H2,1-3H3 |
| InChIKey | ZNSARZOLESYDMT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(3,5-dichloro-2-methoxyphenyl)-[1-(3-methylphenyl)tetrazol-5-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dichloro-2-methoxyphenyl)-[1-(3-methylphenyl)tetrazol-5-yl]methyl]ethanamine?
The IUPAC name of N-[(3,5-dichloro-2-methoxyphenyl)-[1-(3-methylphenyl)tetrazol-5-yl]methyl]ethanamine (CID 3644624) is N-[(3,5-dichloro-2-methoxyphenyl)-[1-(3-methylphenyl)tetrazol-5-yl]methyl]ethanamine.
What is the SMILES notation for N-[(3,5-dichloro-2-methoxyphenyl)-[1-(3-methylphenyl)tetrazol-5-yl]methyl]ethanamine?
The canonical SMILES for N-[(3,5-dichloro-2-methoxyphenyl)-[1-(3-methylphenyl)tetrazol-5-yl]methyl]ethanamine is CCNC(c1cc(Cl)cc(Cl)c1OC)c1nnnn1-c1cccc(C)c1.
What is the InChIKey of N-[(3,5-dichloro-2-methoxyphenyl)-[1-(3-methylphenyl)tetrazol-5-yl]methyl]ethanamine?
The InChIKey is ZNSARZOLESYDMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19Cl2N5O/c1-4-21-16(14-9-12(19)10-15(20)17(14)26-3)18-22-23-24-25(18)13-7-5-6-11(2)8-13/h5-10,16,21H,4H2,1-3H3.
What are the key properties of N-[(3,5-dichloro-2-methoxyphenyl)-[1-(3-methylphenyl)tetrazol-5-yl]methyl]ethanamine?
N-[(3,5-dichloro-2-methoxyphenyl)-[1-(3-methylphenyl)tetrazol-5-yl]methyl]ethanamine has a molecular weight of 392.29 g/mol, XLogP of 3.99, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dichloro-2-methoxyphenyl)-[1-(3-methylphenyl)tetrazol-5-yl]methyl]ethanamine is sourced from PubChem (CID 3644624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).