C35H63F3O9Si7 — CID 3644633
1,3,5,7,9,11,14-heptacyclopentyl-3,7,14-trifluoro-2,4,6,8,10,12,13,15,16-nonaoxa-1,3,5,7,9,11,14-heptasilatricyclo[7.3.3.15,11]hexadecane (PubChem CID 3644633) has the molecular formula C35H63F3O9Si7 and a molecular weight of 881.48 g/mol. Its IUPAC name is 1,3,5,7,9,11,14-heptacyclopentyl-3,7,14-trifluoro-2,4,6,8,10,12,13,15,16-nonaoxa-1,3,5,7,9,11,14-heptasilatricyclo[7.3.3.15,11]hexadecane.
| Compound Name | 1,3,5,7,9,11,14-heptacyclopentyl-3,7,14-trifluoro-2,4,6,8,10,12,13,15,16-nonaoxa-1,3,5,7,9,11,14-heptasilatricyclo[7.3.3.15,11]hexadecane |
|---|---|
| PubChem CID | 3644633 |
| Molecular Formula | C35H63F3O9Si7 |
| Molecular Weight | 881.48 g/mol |
| Exact Mass | 880.28 |
| IUPAC Name | 1,3,5,7,9,11,14-heptacyclopentyl-3,7,14-trifluoro-2,4,6,8,10,12,13,15,16-nonaoxa-1,3,5,7,9,11,14-heptasilatricyclo[7.3.3.15,11]hexadecane |
| SMILES | F[Si]1(C2CCCC2)O[Si]2(C3CCCC3)O[Si](F)(C3CCCC3)O[Si]3(C4CCCC4)O[Si](F)(C4CCCC4)O[Si](C4CCCC4)(O1)O[Si](C1CCCC1)(O2)O3 |
| InChI | InChI=1S/C35H63F3O9Si7/c36-48(29-15-1-2-16-29)39-51(32-21-7-8-22-32)41-49(37,30-17-3-4-18-30)43-53(34-25-11-12-26-34)44-50(38,31-19-5-6-20-31)42-52(40-48,33-23-9-10-24-33)46-54(45-51,47-53)35-27-13-14-28-35/h29-35H,1-28H2 |
| InChIKey | MHANYKIZQPHDKI-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.48 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|