About 1-acetyl-3,5-dihydro-2H-pyrrolo[3,2-c]pyridin-6-one
1-acetyl-3,5-dihydro-2H-pyrrolo[3,2-c]pyridin-6-one (PubChem CID 3645068) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 1-acetyl-3,5-dihydro-2H-pyrrolo[3,2-c]pyridin-6-one.
Molecular Properties
| Compound Name | 1-acetyl-3,5-dihydro-2H-pyrrolo[3,2-c]pyridin-6-one |
| PubChem CID | 3645068 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 1-acetyl-3,5-dihydro-2H-pyrrolo[3,2-c]pyridin-6-one |
| SMILES | CC(=O)N1CCc2c[nH]c(=O)cc21 |
| InChI | InChI=1S/C9H10N2O2/c1-6(12)11-3-2-7-5-10-9(13)4-8(7)11/h4-5H,2-3H2,1H3,(H,10,13) |
| InChIKey | SVRDAVIKXFWGKP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-acetyl-3,5-dihydro-2H-pyrrolo[3,2-c]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-3,5-dihydro-2H-pyrrolo[3,2-c]pyridin-6-one?
The IUPAC name of 1-acetyl-3,5-dihydro-2H-pyrrolo[3,2-c]pyridin-6-one (CID 3645068) is 1-acetyl-3,5-dihydro-2H-pyrrolo[3,2-c]pyridin-6-one.
What is the SMILES notation for 1-acetyl-3,5-dihydro-2H-pyrrolo[3,2-c]pyridin-6-one?
The canonical SMILES for 1-acetyl-3,5-dihydro-2H-pyrrolo[3,2-c]pyridin-6-one is CC(=O)N1CCc2c[nH]c(=O)cc21.
What is the InChIKey of 1-acetyl-3,5-dihydro-2H-pyrrolo[3,2-c]pyridin-6-one?
The InChIKey is SVRDAVIKXFWGKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-6(12)11-3-2-7-5-10-9(13)4-8(7)11/h4-5H,2-3H2,1H3,(H,10,13).
What are the key properties of 1-acetyl-3,5-dihydro-2H-pyrrolo[3,2-c]pyridin-6-one?
1-acetyl-3,5-dihydro-2H-pyrrolo[3,2-c]pyridin-6-one has a molecular weight of 178.19 g/mol, XLogP of 0.28, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-3,5-dihydro-2H-pyrrolo[3,2-c]pyridin-6-one is sourced from PubChem (CID 3645068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).