About 3-(3-methoxypropyl)-4-phenyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol
3-(3-methoxypropyl)-4-phenyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol (PubChem CID 3645256) has the molecular formula C18H21N3O2S
and a molecular weight of 343.45 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-4-phenyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol.
Molecular Properties
| Compound Name | 3-(3-methoxypropyl)-4-phenyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol |
| PubChem CID | 3645256 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 3-(3-methoxypropyl)-4-phenyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol |
| SMILES | COCCCN1/C(=N/c2cccnc2)SCC1(O)c1ccccc1 |
| InChI | InChI=1S/C18H21N3O2S/c1-23-12-6-11-21-17(20-16-9-5-10-19-13-16)24-14-18(21,22)15-7-3-2-4-8-15/h2-5,7-10,13,22H,6,11-12,14H2,1H3/b20-17- |
| InChIKey | DWJWYBKZUFCWCC-JZJYNLBNSA-N |
| XLogP | 3.00 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methoxypropyl)-4-phenyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methoxypropyl)-4-phenyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol?
The IUPAC name of 3-(3-methoxypropyl)-4-phenyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol (CID 3645256) is 3-(3-methoxypropyl)-4-phenyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol.
What is the SMILES notation for 3-(3-methoxypropyl)-4-phenyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol?
The canonical SMILES for 3-(3-methoxypropyl)-4-phenyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol is COCCCN1/C(=N/c2cccnc2)SCC1(O)c1ccccc1.
What is the InChIKey of 3-(3-methoxypropyl)-4-phenyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol?
The InChIKey is DWJWYBKZUFCWCC-JZJYNLBNSA-N. The full InChI is InChI=1S/C18H21N3O2S/c1-23-12-6-11-21-17(20-16-9-5-10-19-13-16)24-14-18(21,22)15-7-3-2-4-8-15/h2-5,7-10,13,22H,6,11-12,14H2,1H3/b20-17-.
What are the key properties of 3-(3-methoxypropyl)-4-phenyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol?
3-(3-methoxypropyl)-4-phenyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol has a molecular weight of 343.45 g/mol, XLogP of 3.00, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methoxypropyl)-4-phenyl-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol is sourced from PubChem (CID 3645256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).