C30H29FN7O3P — CID 3645798
4-[2-cyclopropyl-3-(2-fluorophenyl)-7-methyl-1-(4-nitrophenyl)imino-5-phenylpyrazolo[4,5-c][1,5,2]diazaphosphinin-1-yl]morpholine (PubChem CID 3645798) has the molecular formula C30H29FN7O3P and a molecular weight of 585.58 g/mol. Its IUPAC name is 4-[2-cyclopropyl-3-(2-fluorophenyl)-7-methyl-1-(4-nitrophenyl)imino-5-phenylpyrazolo[4,5-c][1,5,2]diazaphosphinin-1-yl]morpholine.
| Compound Name | 4-[2-cyclopropyl-3-(2-fluorophenyl)-7-methyl-1-(4-nitrophenyl)imino-5-phenylpyrazolo[4,5-c][1,5,2]diazaphosphinin-1-yl]morpholine |
|---|---|
| PubChem CID | 3645798 |
| Molecular Formula | C30H29FN7O3P |
| Molecular Weight | 585.58 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | 4-[2-cyclopropyl-3-(2-fluorophenyl)-7-methyl-1-(4-nitrophenyl)imino-5-phenylpyrazolo[4,5-c][1,5,2]diazaphosphinin-1-yl]morpholine |
| SMILES | Cc1nn(-c2ccccc2)c2c1P(=Nc1ccc([N+](=O)[O-])cc1)(N1CCOCC1)N(C1CC1)C(c1ccccc1F)=N2 |
| InChI | InChI=1S/C30H29FN7O3P/c1-21-28-30(36(33-21)23-7-3-2-4-8-23)32-29(26-9-5-6-10-27(26)31)37(24-15-16-24)42(28,35-17-19-41-20-18-35)34-22-11-13-25(14-12-22)38(39)40/h2-14,24H,15-20H2,1H3 |
| InChIKey | VTKLSZMLXPARBT-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 101.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.58 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|