About 2-(4-amino-2,6-dioxo-5-piperidin-1-yl-3-propylpyrimidin-1-yl)-N-phenylacetamide
2-(4-amino-2,6-dioxo-5-piperidin-1-yl-3-propylpyrimidin-1-yl)-N-phenylacetamide (PubChem CID 3646370) has the molecular formula C20H27N5O3
and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-(4-amino-2,6-dioxo-5-piperidin-1-yl-3-propylpyrimidin-1-yl)-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-(4-amino-2,6-dioxo-5-piperidin-1-yl-3-propylpyrimidin-1-yl)-N-phenylacetamide |
| PubChem CID | 3646370 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 2-(4-amino-2,6-dioxo-5-piperidin-1-yl-3-propylpyrimidin-1-yl)-N-phenylacetamide |
| SMILES | CCCn1c(N)c(N2CCCCC2)c(=O)n(CC(=O)Nc2ccccc2)c1=O |
| InChI | InChI=1S/C20H27N5O3/c1-2-11-24-18(21)17(23-12-7-4-8-13-23)19(27)25(20(24)28)14-16(26)22-15-9-5-3-6-10-15/h3,5-6,9-10H,2,4,7-8,11-14,21H2,1H3,(H,22,26) |
| InChIKey | RNPZJAPHDAWHQG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(4-amino-2,6-dioxo-5-piperidin-1-yl-3-propylpyrimidin-1-yl)-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-2,6-dioxo-5-piperidin-1-yl-3-propylpyrimidin-1-yl)-N-phenylacetamide?
The IUPAC name of 2-(4-amino-2,6-dioxo-5-piperidin-1-yl-3-propylpyrimidin-1-yl)-N-phenylacetamide (CID 3646370) is 2-(4-amino-2,6-dioxo-5-piperidin-1-yl-3-propylpyrimidin-1-yl)-N-phenylacetamide.
What is the SMILES notation for 2-(4-amino-2,6-dioxo-5-piperidin-1-yl-3-propylpyrimidin-1-yl)-N-phenylacetamide?
The canonical SMILES for 2-(4-amino-2,6-dioxo-5-piperidin-1-yl-3-propylpyrimidin-1-yl)-N-phenylacetamide is CCCn1c(N)c(N2CCCCC2)c(=O)n(CC(=O)Nc2ccccc2)c1=O.
What is the InChIKey of 2-(4-amino-2,6-dioxo-5-piperidin-1-yl-3-propylpyrimidin-1-yl)-N-phenylacetamide?
The InChIKey is RNPZJAPHDAWHQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N5O3/c1-2-11-24-18(21)17(23-12-7-4-8-13-23)19(27)25(20(24)28)14-16(26)22-15-9-5-3-6-10-15/h3,5-6,9-10H,2,4,7-8,11-14,21H2,1H3,(H,22,26).
What are the key properties of 2-(4-amino-2,6-dioxo-5-piperidin-1-yl-3-propylpyrimidin-1-yl)-N-phenylacetamide?
2-(4-amino-2,6-dioxo-5-piperidin-1-yl-3-propylpyrimidin-1-yl)-N-phenylacetamide has a molecular weight of 385.47 g/mol, XLogP of 1.63, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-2,6-dioxo-5-piperidin-1-yl-3-propylpyrimidin-1-yl)-N-phenylacetamide is sourced from PubChem (CID 3646370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).