C14H27N3O3 — CID 3647066
N-(2-methoxyethyl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 3647066) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N-(2-methoxyethyl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 3647066 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | N-(2-methoxyethyl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | COCCNC(=O)C(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C14H27N3O3/c1-13(2)8-10(9-14(3,4)17-13)16-12(19)11(18)15-6-7-20-5/h10,17H,6-9H2,1-5H3,(H,15,18)(H,16,19) |
| InChIKey | LSFFIHRMUCYKDJ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|